C16H12F2N2O3 — CID 174533299
1-benzyl-4,6-difluoro-5-methoxyindazole-3-carboxylic acid (PubChem CID 174533299) has the molecular formula C16H12F2N2O3 and a molecular weight of 318.28 g/mol. Its IUPAC name is 1-benzyl-4,6-difluoro-5-methoxyindazole-3-carboxylic acid.
| Compound Name | 1-benzyl-4,6-difluoro-5-methoxyindazole-3-carboxylic acid |
|---|---|
| PubChem CID | 174533299 |
| Molecular Formula | C16H12F2N2O3 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 1-benzyl-4,6-difluoro-5-methoxyindazole-3-carboxylic acid |
| SMILES | COc1c(F)cc2c(c(C(=O)O)nn2Cc2ccccc2)c1F |
| InChI | InChI=1S/C16H12F2N2O3/c1-23-15-10(17)7-11-12(13(15)18)14(16(21)22)19-20(11)8-9-5-3-2-4-6-9/h2-7H,8H2,1H3,(H,21,22) |
| InChIKey | HHWNSGCPBXFJAC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |