1-benzyl-4,6-difluoro-5-methoxyindazole-3-carboxylic acid

C16H12F2N2O3 — CID 174533299

IUPAC1-benzyl-4,6-difluoro-5-methoxyindazole-3-carboxylic acid
SMILESCOc1c(F)cc2c(c(C(=O)O)nn2Cc2ccccc2)c1F
InChIInChI=1S/C16H12F2N2O3/c1-23-15-10(17)7-11-12(13(15)18)14(16(21)22)19-20(11)8-9-5-3-2-4-6-9/h2-7H,8H2,1H3,(H,21,22)
InChIKeyHHWNSGCPBXFJAC-UHFFFAOYSA-N
MW318.28 g/mol
LogP3.07
Rot. Bonds4

About 1-benzyl-4,6-difluoro-5-methoxyindazole-3-carboxylic acid

1-benzyl-4,6-difluoro-5-methoxyindazole-3-carboxylic acid (PubChem CID 174533299) has the molecular formula C16H12F2N2O3 and a molecular weight of 318.28 g/mol. Its IUPAC name is 1-benzyl-4,6-difluoro-5-methoxyindazole-3-carboxylic acid.

Molecular Properties

Compound Name1-benzyl-4,6-difluoro-5-methoxyindazole-3-carboxylic acid
PubChem CID174533299
Molecular FormulaC16H12F2N2O3
Molecular Weight318.28 g/mol
Exact Mass318.08
IUPAC Name1-benzyl-4,6-difluoro-5-methoxyindazole-3-carboxylic acid
SMILESCOc1c(F)cc2c(c(C(=O)O)nn2Cc2ccccc2)c1F
InChIInChI=1S/C16H12F2N2O3/c1-23-15-10(17)7-11-12(13(15)18)14(16(21)22)19-20(11)8-9-5-3-2-4-6-9/h2-7H,8H2,1H3,(H,21,22)
InChIKeyHHWNSGCPBXFJAC-UHFFFAOYSA-N
XLogP3.07
TPSA64.35 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.28
LogP ≤ 53.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-benzyl-4,6-difluoro-5-methoxyindazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-benzyl-4,6-difluoro-5-methoxyindazole-3-carboxylic acid?
The IUPAC name of 1-benzyl-4,6-difluoro-5-methoxyindazole-3-carboxylic acid (CID 174533299) is 1-benzyl-4,6-difluoro-5-methoxyindazole-3-carboxylic acid.
What is the SMILES notation for 1-benzyl-4,6-difluoro-5-methoxyindazole-3-carboxylic acid?
The canonical SMILES for 1-benzyl-4,6-difluoro-5-methoxyindazole-3-carboxylic acid is COc1c(F)cc2c(c(C(=O)O)nn2Cc2ccccc2)c1F.
What is the InChIKey of 1-benzyl-4,6-difluoro-5-methoxyindazole-3-carboxylic acid?
The InChIKey is HHWNSGCPBXFJAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F2N2O3/c1-23-15-10(17)7-11-12(13(15)18)14(16(21)22)19-20(11)8-9-5-3-2-4-6-9/h2-7H,8H2,1H3,(H,21,22).
What are the key properties of 1-benzyl-4,6-difluoro-5-methoxyindazole-3-carboxylic acid?
1-benzyl-4,6-difluoro-5-methoxyindazole-3-carboxylic acid has a molecular weight of 318.28 g/mol, XLogP of 3.07, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4,6-difluoro-5-methoxyindazole-3-carboxylic acid is sourced from PubChem (CID 174533299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).