About 6-methylheptyl 2-sulfanylacetate;neodymium
6-methylheptyl 2-sulfanylacetate;neodymium (PubChem CID 174534335) has the molecular formula C10H20NdO2S
and a molecular weight of 348.58 g/mol. Its IUPAC name is 6-methylheptyl 2-sulfanylacetate;neodymium.
Molecular Properties
| Compound Name | 6-methylheptyl 2-sulfanylacetate;neodymium |
| PubChem CID | 174534335 |
| Molecular Formula | C10H20NdO2S |
| Molecular Weight | 348.58 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 6-methylheptyl 2-sulfanylacetate;neodymium |
| SMILES | CC(C)CCCCCOC(=O)CS.[Nd] |
| InChI | InChI=1S/C10H20O2S.Nd/c1-9(2)6-4-3-5-7-12-10(11)8-13;/h9,13H,3-8H2,1-2H3; |
| InChIKey | PIHAUDPRRUYJKX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.58 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 6-methylheptyl 2-sulfanylacetate;neodymium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylheptyl 2-sulfanylacetate;neodymium?
The IUPAC name of 6-methylheptyl 2-sulfanylacetate;neodymium (CID 174534335) is 6-methylheptyl 2-sulfanylacetate;neodymium.
What is the SMILES notation for 6-methylheptyl 2-sulfanylacetate;neodymium?
The canonical SMILES for 6-methylheptyl 2-sulfanylacetate;neodymium is CC(C)CCCCCOC(=O)CS.[Nd].
What is the InChIKey of 6-methylheptyl 2-sulfanylacetate;neodymium?
The InChIKey is PIHAUDPRRUYJKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2S.Nd/c1-9(2)6-4-3-5-7-12-10(11)8-13;/h9,13H,3-8H2,1-2H3;.
What are the key properties of 6-methylheptyl 2-sulfanylacetate;neodymium?
6-methylheptyl 2-sulfanylacetate;neodymium has a molecular weight of 348.58 g/mol, XLogP of 2.68, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylheptyl 2-sulfanylacetate;neodymium is sourced from PubChem (CID 174534335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).