C30H34N2O2S — CID 174534482
[2-[1-[2-[2-(4-methylsulfanylphenyl)morpholin-4-yl]propylamino]prop-2-enyl]phenyl]-phenylmethanone (PubChem CID 174534482) has the molecular formula C30H34N2O2S and a molecular weight of 486.68 g/mol. Its IUPAC name is [2-[1-[2-[2-(4-methylsulfanylphenyl)morpholin-4-yl]propylamino]prop-2-enyl]phenyl]-phenylmethanone.
| Compound Name | [2-[1-[2-[2-(4-methylsulfanylphenyl)morpholin-4-yl]propylamino]prop-2-enyl]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 174534482 |
| Molecular Formula | C30H34N2O2S |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | [2-[1-[2-[2-(4-methylsulfanylphenyl)morpholin-4-yl]propylamino]prop-2-enyl]phenyl]-phenylmethanone |
| SMILES | C=CC(NCC(C)N1CCOC(c2ccc(SC)cc2)C1)c1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C30H34N2O2S/c1-4-28(26-12-8-9-13-27(26)30(33)24-10-6-5-7-11-24)31-20-22(2)32-18-19-34-29(21-32)23-14-16-25(35-3)17-15-23/h4-17,22,28-29,31H,1,18-21H2,2-3H3 |
| InChIKey | JJLZLIYRDLWQMI-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|