C18H20FNO — CID 67352997
(2S)-2-(4-fluorophenyl)-4-[(1R)-1-phenylethyl]morpholine (PubChem CID 67352997) has the molecular formula C18H20FNO and a molecular weight of 285.36 g/mol. Its IUPAC name is (2S)-2-(4-fluorophenyl)-4-[(1R)-1-phenylethyl]morpholine.
| Compound Name | (2S)-2-(4-fluorophenyl)-4-[(1R)-1-phenylethyl]morpholine |
|---|---|
| PubChem CID | 67352997 |
| Molecular Formula | C18H20FNO |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | (2S)-2-(4-fluorophenyl)-4-[(1R)-1-phenylethyl]morpholine |
| SMILES | C[C@H](c1ccccc1)N1CCO[C@@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C18H20FNO/c1-14(15-5-3-2-4-6-15)20-11-12-21-18(13-20)16-7-9-17(19)10-8-16/h2-10,14,18H,11-13H2,1H3/t14-,18-/m1/s1 |
| InChIKey | SOBARSZDTPGQEA-RDTXWAMCSA-N |
| XLogP | 3.96 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |