C19H23N3O2 — CID 91313579
N'-hydroxy-4-[(2S)-4-[(1R)-1-phenylethyl]morpholin-2-yl]benzenecarboximidamide (PubChem CID 91313579) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is N'-hydroxy-4-[(2S)-4-[(1R)-1-phenylethyl]morpholin-2-yl]benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[(2S)-4-[(1R)-1-phenylethyl]morpholin-2-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 91313579 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N'-hydroxy-4-[(2S)-4-[(1R)-1-phenylethyl]morpholin-2-yl]benzenecarboximidamide |
| SMILES | C[C@H](c1ccccc1)N1CCO[C@@H](c2ccc(C(N)=NO)cc2)C1 |
| InChI | InChI=1S/C19H23N3O2/c1-14(15-5-3-2-4-6-15)22-11-12-24-18(13-22)16-7-9-17(10-8-16)19(20)21-23/h2-10,14,18,23H,11-13H2,1H3,(H2,20,21)/t14-,18-/m1/s1 |
| InChIKey | PVIXPSJKRWQXIP-RDTXWAMCSA-N |
| XLogP | 2.92 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|