C18H21N7O2S — CID 174536044
N-[5-[amino(formyl)amino]-2H-thieno[2,3-c]pyrazol-3-yl]-4-(4-methylpiperazin-1-yl)benzamide (PubChem CID 174536044) has the molecular formula C18H21N7O2S and a molecular weight of 399.48 g/mol. Its IUPAC name is N-[5-[amino(formyl)amino]-2H-thieno[2,3-c]pyrazol-3-yl]-4-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | N-[5-[amino(formyl)amino]-2H-thieno[2,3-c]pyrazol-3-yl]-4-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 174536044 |
| Molecular Formula | C18H21N7O2S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | N-[5-[amino(formyl)amino]-2H-thieno[2,3-c]pyrazol-3-yl]-4-(4-methylpiperazin-1-yl)benzamide |
| SMILES | CN1CCN(c2ccc(C(=O)Nc3[nH]nc4sc(N(N)C=O)cc34)cc2)CC1 |
| InChI | InChI=1S/C18H21N7O2S/c1-23-6-8-24(9-7-23)13-4-2-12(3-5-13)17(27)20-16-14-10-15(25(19)11-26)28-18(14)22-21-16/h2-5,10-11H,6-9,19H2,1H3,(H2,20,21,22,27) |
| InChIKey | YTTBYWHFZDVBGK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 110.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|