C29H33ClN7O2S+ — CID 91606286
(4-chlorophenyl)-cyclobutyl-methyl-[[3-[[4-(4-methylpiperazin-1-yl)benzoyl]amino]-2H-thieno[2,3-c]pyrazole-5-carbonyl]amino]azanium (PubChem CID 91606286) has the molecular formula C29H33ClN7O2S+ and a molecular weight of 579.15 g/mol. Its IUPAC name is (4-chlorophenyl)-cyclobutyl-methyl-[[3-[[4-(4-methylpiperazin-1-yl)benzoyl]amino]-2H-thieno[2,3-c]pyrazole-5-carbonyl]amino]azanium.
| Compound Name | (4-chlorophenyl)-cyclobutyl-methyl-[[3-[[4-(4-methylpiperazin-1-yl)benzoyl]amino]-2H-thieno[2,3-c]pyrazole-5-carbonyl]amino]azanium |
|---|---|
| PubChem CID | 91606286 |
| Molecular Formula | C29H33ClN7O2S+ |
| Molecular Weight | 579.15 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | (4-chlorophenyl)-cyclobutyl-methyl-[[3-[[4-(4-methylpiperazin-1-yl)benzoyl]amino]-2H-thieno[2,3-c]pyrazole-5-carbonyl]amino]azanium |
| SMILES | CN1CCN(c2ccc(C(=O)Nc3[nH]nc4sc(C(=O)N[N+](C)(c5ccc(Cl)cc5)C5CCC5)cc34)cc2)CC1 |
| InChI | InChI=1S/C29H32ClN7O2S/c1-35-14-16-36(17-15-35)21-10-6-19(7-11-21)27(38)31-26-24-18-25(40-29(24)33-32-26)28(39)34-37(2,22-4-3-5-22)23-12-8-20(30)9-13-23/h6-13,18,22H,3-5,14-17H2,1-2H3,(H2-,31,32,33,34,38,39)/p+1 |
| InChIKey | SBMBCKUSZVXPGT-UHFFFAOYSA-O |
| XLogP | 5.12 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.15 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|