C23H20FN5O3S — CID 67398195
3-[(3-fluorobenzoyl)amino]-N-(4-morpholin-4-ylphenyl)-2H-thieno[2,3-c]pyrazole-5-carboxamide (PubChem CID 67398195) has the molecular formula C23H20FN5O3S and a molecular weight of 465.51 g/mol. Its IUPAC name is 3-[(3-fluorobenzoyl)amino]-N-(4-morpholin-4-ylphenyl)-2H-thieno[2,3-c]pyrazole-5-carboxamide.
| Compound Name | 3-[(3-fluorobenzoyl)amino]-N-(4-morpholin-4-ylphenyl)-2H-thieno[2,3-c]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 67398195 |
| Molecular Formula | C23H20FN5O3S |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 3-[(3-fluorobenzoyl)amino]-N-(4-morpholin-4-ylphenyl)-2H-thieno[2,3-c]pyrazole-5-carboxamide |
| SMILES | O=C(Nc1[nH]nc2sc(C(=O)Nc3ccc(N4CCOCC4)cc3)cc12)c1cccc(F)c1 |
| InChI | InChI=1S/C23H20FN5O3S/c24-15-3-1-2-14(12-15)21(30)26-20-18-13-19(33-23(18)28-27-20)22(31)25-16-4-6-17(7-5-16)29-8-10-32-11-9-29/h1-7,12-13H,8-11H2,(H,25,31)(H2,26,27,28,30) |
| InChIKey | WOECNDJYHLXCJP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|