C8H9F3N2O2 — CID 174537215
1-[5-(trifluoromethyl)-1H-pyrazol-4-yl]propan-2-yl formate (PubChem CID 174537215) has the molecular formula C8H9F3N2O2 and a molecular weight of 222.17 g/mol. Its IUPAC name is 1-[5-(trifluoromethyl)-1H-pyrazol-4-yl]propan-2-yl formate.
| Compound Name | 1-[5-(trifluoromethyl)-1H-pyrazol-4-yl]propan-2-yl formate |
|---|---|
| PubChem CID | 174537215 |
| Molecular Formula | C8H9F3N2O2 |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 1-[5-(trifluoromethyl)-1H-pyrazol-4-yl]propan-2-yl formate |
| SMILES | CC(Cc1cn[nH]c1C(F)(F)F)OC=O |
| InChI | InChI=1S/C8H9F3N2O2/c1-5(15-4-14)2-6-3-12-13-7(6)8(9,10)11/h3-5H,2H2,1H3,(H,12,13) |
| InChIKey | OOJBSONTMGAMDT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|