C21H38O2 — CID 174537712
3-(12-hydroxydodecyl)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde (PubChem CID 174537712) has the molecular formula C21H38O2 and a molecular weight of 322.53 g/mol. Its IUPAC name is 3-(12-hydroxydodecyl)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde.
| Compound Name | 3-(12-hydroxydodecyl)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 174537712 |
| Molecular Formula | C21H38O2 |
| Molecular Weight | 322.53 g/mol |
| Exact Mass | 322.29 |
| IUPAC Name | 3-(12-hydroxydodecyl)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde |
| SMILES | CC1(C)CCC(C=O)C=C1CCCCCCCCCCCCO |
| InChI | InChI=1S/C21H38O2/c1-21(2)15-14-19(18-23)17-20(21)13-11-9-7-5-3-4-6-8-10-12-16-22/h17-19,22H,3-16H2,1-2H3 |
| InChIKey | KPVNKKZEERRDAW-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.53 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|