C20H36O2 — CID 174552184
3-(11-hydroxyundecyl)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde (PubChem CID 174552184) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is 3-(11-hydroxyundecyl)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde.
| Compound Name | 3-(11-hydroxyundecyl)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 174552184 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | 3-(11-hydroxyundecyl)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde |
| SMILES | CC1(C)CCC(C=O)C=C1CCCCCCCCCCCO |
| InChI | InChI=1S/C20H36O2/c1-20(2)14-13-18(17-22)16-19(20)12-10-8-6-4-3-5-7-9-11-15-21/h16-18,21H,3-15H2,1-2H3 |
| InChIKey | SFDOYOFTHQNOHF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|