About 3-(11-hydroxyundecyl)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde
3-(11-hydroxyundecyl)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde (PubChem CID 174552184) has the molecular formula C20H36O2
and a molecular weight of 308.51 g/mol. Its IUPAC name is 3-(11-hydroxyundecyl)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde.
Molecular Properties
| Compound Name | 3-(11-hydroxyundecyl)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde |
| PubChem CID | 174552184 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | 3-(11-hydroxyundecyl)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde |
| SMILES | CC1(C)CCC(C=O)C=C1CCCCCCCCCCCO |
| InChI | InChI=1S/C20H36O2/c1-20(2)14-13-18(17-22)16-19(20)12-10-8-6-4-3-5-7-9-11-15-21/h16-18,21H,3-15H2,1-2H3 |
| InChIKey | SFDOYOFTHQNOHF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(11-hydroxyundecyl)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(11-hydroxyundecyl)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde?
The IUPAC name of 3-(11-hydroxyundecyl)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde (CID 174552184) is 3-(11-hydroxyundecyl)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde.
What is the SMILES notation for 3-(11-hydroxyundecyl)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde?
The canonical SMILES for 3-(11-hydroxyundecyl)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde is CC1(C)CCC(C=O)C=C1CCCCCCCCCCCO.
What is the InChIKey of 3-(11-hydroxyundecyl)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde?
The InChIKey is SFDOYOFTHQNOHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36O2/c1-20(2)14-13-18(17-22)16-19(20)12-10-8-6-4-3-5-7-9-11-15-21/h16-18,21H,3-15H2,1-2H3.
What are the key properties of 3-(11-hydroxyundecyl)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde?
3-(11-hydroxyundecyl)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde has a molecular weight of 308.51 g/mol, XLogP of 5.44, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(11-hydroxyundecyl)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde is sourced from PubChem (CID 174552184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).