C21H23N3O4S — CID 174540439
1-[4-[(2R)-1-oxo-3-[(1R)-3-oxocyclopentyl]-1-(pyrazin-2-ylamino)propan-2-yl]phenyl]cyclopropane-1-sulfinic acid (PubChem CID 174540439) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is 1-[4-[(2R)-1-oxo-3-[(1R)-3-oxocyclopentyl]-1-(pyrazin-2-ylamino)propan-2-yl]phenyl]cyclopropane-1-sulfinic acid.
| Compound Name | 1-[4-[(2R)-1-oxo-3-[(1R)-3-oxocyclopentyl]-1-(pyrazin-2-ylamino)propan-2-yl]phenyl]cyclopropane-1-sulfinic acid |
|---|---|
| PubChem CID | 174540439 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 1-[4-[(2R)-1-oxo-3-[(1R)-3-oxocyclopentyl]-1-(pyrazin-2-ylamino)propan-2-yl]phenyl]cyclopropane-1-sulfinic acid |
| SMILES | O=C1CC[C@H](C[C@@H](C(=O)Nc2cnccn2)c2ccc(C3(S(=O)O)CC3)cc2)C1 |
| InChI | InChI=1S/C21H23N3O4S/c25-17-6-1-14(11-17)12-18(20(26)24-19-13-22-9-10-23-19)15-2-4-16(5-3-15)21(7-8-21)29(27)28/h2-5,9-10,13-14,18H,1,6-8,11-12H2,(H,27,28)(H,23,24,26)/t14-,18+/m0/s1 |
| InChIKey | PJWIXXPDQBNAGS-KBXCAEBGSA-N |
| XLogP | 3.17 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|