C7H15Cl2O5PS — CID 174543321
2-(2,2-dichlorobutylsulfinyl)ethyl methyl hydrogen phosphate (PubChem CID 174543321) has the molecular formula C7H15Cl2O5PS and a molecular weight of 313.14 g/mol. Its IUPAC name is 2-(2,2-dichlorobutylsulfinyl)ethyl methyl hydrogen phosphate.
| Compound Name | 2-(2,2-dichlorobutylsulfinyl)ethyl methyl hydrogen phosphate |
|---|---|
| PubChem CID | 174543321 |
| Molecular Formula | C7H15Cl2O5PS |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 311.98 |
| IUPAC Name | 2-(2,2-dichlorobutylsulfinyl)ethyl methyl hydrogen phosphate |
| SMILES | CCC(Cl)(Cl)CS(=O)CCOP(=O)(O)OC |
| InChI | InChI=1S/C7H15Cl2O5PS/c1-3-7(8,9)6-16(12)5-4-14-15(10,11)13-2/h3-6H2,1-2H3,(H,10,11) |
| InChIKey | OBKUIWWSHNIEAE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|