About benzene;ethyl 9-propylidenefluorene-4-carboxylate
benzene;ethyl 9-propylidenefluorene-4-carboxylate (PubChem CID 174544790) has the molecular formula C25H24O2
and a molecular weight of 356.47 g/mol. Its IUPAC name is benzene;ethyl 9-propylidenefluorene-4-carboxylate.
Molecular Properties
| Compound Name | benzene;ethyl 9-propylidenefluorene-4-carboxylate |
| PubChem CID | 174544790 |
| Molecular Formula | C25H24O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | benzene;ethyl 9-propylidenefluorene-4-carboxylate |
| SMILES | CCC=C1c2ccccc2-c2c(C(=O)OCC)cccc21.c1ccccc1 |
| InChI | InChI=1S/C19H18O2.C6H6/c1-3-8-13-14-9-5-6-10-15(14)18-16(13)11-7-12-17(18)19(20)21-4-2;1-2-4-6-5-3-1/h5-12H,3-4H2,1-2H3;1-6H |
| InChIKey | DCGQTKYBBWQQAI-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene;ethyl 9-propylidenefluorene-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;ethyl 9-propylidenefluorene-4-carboxylate?
The IUPAC name of benzene;ethyl 9-propylidenefluorene-4-carboxylate (CID 174544790) is benzene;ethyl 9-propylidenefluorene-4-carboxylate.
What is the SMILES notation for benzene;ethyl 9-propylidenefluorene-4-carboxylate?
The canonical SMILES for benzene;ethyl 9-propylidenefluorene-4-carboxylate is CCC=C1c2ccccc2-c2c(C(=O)OCC)cccc21.c1ccccc1.
What is the InChIKey of benzene;ethyl 9-propylidenefluorene-4-carboxylate?
The InChIKey is DCGQTKYBBWQQAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18O2.C6H6/c1-3-8-13-14-9-5-6-10-15(14)18-16(13)11-7-12-17(18)19(20)21-4-2;1-2-4-6-5-3-1/h5-12H,3-4H2,1-2H3;1-6H.
What are the key properties of benzene;ethyl 9-propylidenefluorene-4-carboxylate?
benzene;ethyl 9-propylidenefluorene-4-carboxylate has a molecular weight of 356.47 g/mol, XLogP of 6.37, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;ethyl 9-propylidenefluorene-4-carboxylate is sourced from PubChem (CID 174544790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).