C14H26O4 — CID 174547782
4-hexyl-3,3-bis(hydroxymethyl)hexane-2,5-dione (PubChem CID 174547782) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is 4-hexyl-3,3-bis(hydroxymethyl)hexane-2,5-dione.
| Compound Name | 4-hexyl-3,3-bis(hydroxymethyl)hexane-2,5-dione |
|---|---|
| PubChem CID | 174547782 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 4-hexyl-3,3-bis(hydroxymethyl)hexane-2,5-dione |
| SMILES | CCCCCCC(C(C)=O)C(CO)(CO)C(C)=O |
| InChI | InChI=1S/C14H26O4/c1-4-5-6-7-8-13(11(2)17)14(9-15,10-16)12(3)18/h13,15-16H,4-10H2,1-3H3 |
| InChIKey | VZZYDVTXAQLLNR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|