C19H22FN3O3S — CID 174548115
N'-(3-fluorophenyl)-3,3-dimethyl-N-(N-methylsulfonylanilino)-2-oxobutanimidamide (PubChem CID 174548115) has the molecular formula C19H22FN3O3S and a molecular weight of 391.47 g/mol. Its IUPAC name is N'-(3-fluorophenyl)-3,3-dimethyl-N-(N-methylsulfonylanilino)-2-oxobutanimidamide.
| Compound Name | N'-(3-fluorophenyl)-3,3-dimethyl-N-(N-methylsulfonylanilino)-2-oxobutanimidamide |
|---|---|
| PubChem CID | 174548115 |
| Molecular Formula | C19H22FN3O3S |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | N'-(3-fluorophenyl)-3,3-dimethyl-N-(N-methylsulfonylanilino)-2-oxobutanimidamide |
| SMILES | CC(C)(C)C(=O)/C(=N\c1cccc(F)c1)NN(c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C19H22FN3O3S/c1-19(2,3)17(24)18(21-15-10-8-9-14(20)13-15)22-23(27(4,25)26)16-11-6-5-7-12-16/h5-13H,1-4H3,(H,21,22) |
| InChIKey | JWOSZPZLRMYKBC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|