About N-[3-(3,3-dimethylbutan-2-ylideneamino)phenyl]-N-methylmethanesulfonamide
N-[3-(3,3-dimethylbutan-2-ylideneamino)phenyl]-N-methylmethanesulfonamide (PubChem CID 3426667) has the molecular formula C14H22N2O2S
and a molecular weight of 282.41 g/mol. Its IUPAC name is N-[3-(3,3-dimethylbutan-2-ylideneamino)phenyl]-N-methylmethanesulfonamide.
Molecular Properties
| Compound Name | N-[3-(3,3-dimethylbutan-2-ylideneamino)phenyl]-N-methylmethanesulfonamide |
| PubChem CID | 3426667 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-[3-(3,3-dimethylbutan-2-ylideneamino)phenyl]-N-methylmethanesulfonamide |
| SMILES | C/C(=N\c1cccc(N(C)S(C)(=O)=O)c1)C(C)(C)C |
| InChI | InChI=1S/C14H22N2O2S/c1-11(14(2,3)4)15-12-8-7-9-13(10-12)16(5)19(6,17)18/h7-10H,1-6H3/b15-11+ |
| InChIKey | DTPBQRFKOSOMQK-RVDMUPIBSA-N |
| XLogP | 3.22 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(3,3-dimethylbutan-2-ylideneamino)phenyl]-N-methylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(3,3-dimethylbutan-2-ylideneamino)phenyl]-N-methylmethanesulfonamide?
The IUPAC name of N-[3-(3,3-dimethylbutan-2-ylideneamino)phenyl]-N-methylmethanesulfonamide (CID 3426667) is N-[3-(3,3-dimethylbutan-2-ylideneamino)phenyl]-N-methylmethanesulfonamide.
What is the SMILES notation for N-[3-(3,3-dimethylbutan-2-ylideneamino)phenyl]-N-methylmethanesulfonamide?
The canonical SMILES for N-[3-(3,3-dimethylbutan-2-ylideneamino)phenyl]-N-methylmethanesulfonamide is C/C(=N\c1cccc(N(C)S(C)(=O)=O)c1)C(C)(C)C.
What is the InChIKey of N-[3-(3,3-dimethylbutan-2-ylideneamino)phenyl]-N-methylmethanesulfonamide?
The InChIKey is DTPBQRFKOSOMQK-RVDMUPIBSA-N. The full InChI is InChI=1S/C14H22N2O2S/c1-11(14(2,3)4)15-12-8-7-9-13(10-12)16(5)19(6,17)18/h7-10H,1-6H3/b15-11+.
What are the key properties of N-[3-(3,3-dimethylbutan-2-ylideneamino)phenyl]-N-methylmethanesulfonamide?
N-[3-(3,3-dimethylbutan-2-ylideneamino)phenyl]-N-methylmethanesulfonamide has a molecular weight of 282.41 g/mol, XLogP of 3.22, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(3,3-dimethylbutan-2-ylideneamino)phenyl]-N-methylmethanesulfonamide is sourced from PubChem (CID 3426667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).