C15H16ClN3O3S — CID 2224615
1-(3-chlorophenyl)-3-[3-[methyl(methylsulfonyl)amino]phenyl]urea (PubChem CID 2224615) has the molecular formula C15H16ClN3O3S and a molecular weight of 353.83 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[3-[methyl(methylsulfonyl)amino]phenyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[3-[methyl(methylsulfonyl)amino]phenyl]urea |
|---|---|
| PubChem CID | 2224615 |
| Molecular Formula | C15H16ClN3O3S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[3-[methyl(methylsulfonyl)amino]phenyl]urea |
| SMILES | CN(c1cccc(NC(=O)Nc2cccc(Cl)c2)c1)S(C)(=O)=O |
| InChI | InChI=1S/C15H16ClN3O3S/c1-19(23(2,21)22)14-8-4-7-13(10-14)18-15(20)17-12-6-3-5-11(16)9-12/h3-10H,1-2H3,(H2,17,18,20) |
| InChIKey | UPPOPLUMQLTCIE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |