C25H15Cl6N3O5S2 — CID 10122938
1-[3-[bis[(3,5-dichlorophenyl)sulfonyl]amino]phenyl]-3-(3,5-dichlorophenyl)urea (PubChem CID 10122938) has the molecular formula C25H15Cl6N3O5S2 and a molecular weight of 714.26 g/mol. Its IUPAC name is 1-[3-[bis[(3,5-dichlorophenyl)sulfonyl]amino]phenyl]-3-(3,5-dichlorophenyl)urea.
| Compound Name | 1-[3-[bis[(3,5-dichlorophenyl)sulfonyl]amino]phenyl]-3-(3,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 10122938 |
| Molecular Formula | C25H15Cl6N3O5S2 |
| Molecular Weight | 714.26 g/mol |
| Exact Mass | 710.86 |
| IUPAC Name | 1-[3-[bis[(3,5-dichlorophenyl)sulfonyl]amino]phenyl]-3-(3,5-dichlorophenyl)urea |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)Nc1cccc(N(S(=O)(=O)c2cc(Cl)cc(Cl)c2)S(=O)(=O)c2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C25H15Cl6N3O5S2/c26-14-4-15(27)8-21(7-14)33-25(35)32-20-2-1-3-22(13-20)34(40(36,37)23-9-16(28)5-17(29)10-23)41(38,39)24-11-18(30)6-19(31)12-24/h1-13H,(H2,32,33,35) |
| InChIKey | NSMPPTJTBHMFHR-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.26 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |