C13H18FN3O — CID 174548668
8-fluoro-3-piperidin-4-yl-2,4-dihydro-1H-quinazolin-2-ol (PubChem CID 174548668) has the molecular formula C13H18FN3O and a molecular weight of 251.30 g/mol. Its IUPAC name is 8-fluoro-3-piperidin-4-yl-2,4-dihydro-1H-quinazolin-2-ol.
| Compound Name | 8-fluoro-3-piperidin-4-yl-2,4-dihydro-1H-quinazolin-2-ol |
|---|---|
| PubChem CID | 174548668 |
| Molecular Formula | C13H18FN3O |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 8-fluoro-3-piperidin-4-yl-2,4-dihydro-1H-quinazolin-2-ol |
| SMILES | OC1Nc2c(F)cccc2CN1C1CCNCC1 |
| InChI | InChI=1S/C13H18FN3O/c14-11-3-1-2-9-8-17(13(18)16-12(9)11)10-4-6-15-7-5-10/h1-3,10,13,15-16,18H,4-8H2 |
| InChIKey | VSFYQVRSOMYIMP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |