C12H19N3O2 — CID 174550199
[4-(2-aminoethyl)-2-pyridinyl] N-tert-butylcarbamate (PubChem CID 174550199) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is [4-(2-aminoethyl)-2-pyridinyl] N-tert-butylcarbamate.
| Compound Name | [4-(2-aminoethyl)-2-pyridinyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174550199 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | [4-(2-aminoethyl)-2-pyridinyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)Oc1cc(CCN)ccn1 |
| InChI | InChI=1S/C12H19N3O2/c1-12(2,3)15-11(16)17-10-8-9(4-6-13)5-7-14-10/h5,7-8H,4,6,13H2,1-3H3,(H,15,16) |
| InChIKey | DSJOCSAJRMHPNW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |