C58H108N2O6 — CID 174550922
6,8-ditert-butyl-N'-[(Z)-6,8-ditert-butyl-7-hydroxy-4-oxohenicos-12-enoyl]-7-hydroxy-4-oxohenicos-12-enehydrazide (PubChem CID 174550922) has the molecular formula C58H108N2O6 and a molecular weight of 929.51 g/mol. Its IUPAC name is 6,8-ditert-butyl-N'-[(Z)-6,8-ditert-butyl-7-hydroxy-4-oxohenicos-12-enoyl]-7-hydroxy-4-oxohenicos-12-enehydrazide.
| Compound Name | 6,8-ditert-butyl-N'-[(Z)-6,8-ditert-butyl-7-hydroxy-4-oxohenicos-12-enoyl]-7-hydroxy-4-oxohenicos-12-enehydrazide |
|---|---|
| PubChem CID | 174550922 |
| Molecular Formula | C58H108N2O6 |
| Molecular Weight | 929.51 g/mol |
| Exact Mass | 928.82 |
| IUPAC Name | 6,8-ditert-butyl-N'-[(Z)-6,8-ditert-butyl-7-hydroxy-4-oxohenicos-12-enoyl]-7-hydroxy-4-oxohenicos-12-enehydrazide |
| SMILES | CCCCCCCCC=CCCCC(C(O)C(CC(=O)CCC(=O)NNC(=O)CCC(=O)CC(C(O)C(CCC/C=C\CCCCCCCC)C(C)(C)C)C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C58H108N2O6/c1-15-17-19-21-23-25-27-29-31-33-35-37-47(55(3,4)5)53(65)49(57(9,10)11)43-45(61)39-41-51(63)59-60-52(64)42-40-46(62)44-50(58(12,13)14)54(66)48(56(6,7)8)38-36-34-32-30-28-26-24-22-20-18-16-2/h29-32,47-50,53-54,65-66H,15-28,33-44H2,1-14H3,(H,59,63)(H,60,64)/b31-29-,32-30? |
| InChIKey | ISVVKZGZVZPEFQ-KTYXQPBJSA-N |
| XLogP | 14.94 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.51 |
| LogP ≤ 5 | 14.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|