C14H16NO6S- — CID 174552088
(3-cyano-4-ethoxyphenyl)methanesulfinate;3-oxobutanoic acid (PubChem CID 174552088) has the molecular formula C14H16NO6S- and a molecular weight of 326.35 g/mol. Its IUPAC name is (3-cyano-4-ethoxyphenyl)methanesulfinate;3-oxobutanoic acid.
| Compound Name | (3-cyano-4-ethoxyphenyl)methanesulfinate;3-oxobutanoic acid |
|---|---|
| PubChem CID | 174552088 |
| Molecular Formula | C14H16NO6S- |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | (3-cyano-4-ethoxyphenyl)methanesulfinate;3-oxobutanoic acid |
| SMILES | CC(=O)CC(=O)O.CCOc1ccc(CS(=O)[O-])cc1C#N |
| InChI | InChI=1S/C10H11NO3S.C4H6O3/c1-2-14-10-4-3-8(7-15(12)13)5-9(10)6-11;1-3(5)2-4(6)7/h3-5H,2,7H2,1H3,(H,12,13);2H2,1H3,(H,6,7)/p-1 |
| InChIKey | DQOXMTRSESOWMP-UHFFFAOYSA-M |
| XLogP | 1.39 |
| TPSA | 127.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|