C17H16ClN3O4 — CID 174908478
4-(6-chloropyrimidin-4-yl)-2-ethoxybenzonitrile;3-oxobutanoic acid (PubChem CID 174908478) has the molecular formula C17H16ClN3O4 and a molecular weight of 361.79 g/mol. Its IUPAC name is 4-(6-chloropyrimidin-4-yl)-2-ethoxybenzonitrile;3-oxobutanoic acid.
| Compound Name | 4-(6-chloropyrimidin-4-yl)-2-ethoxybenzonitrile;3-oxobutanoic acid |
|---|---|
| PubChem CID | 174908478 |
| Molecular Formula | C17H16ClN3O4 |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 4-(6-chloropyrimidin-4-yl)-2-ethoxybenzonitrile;3-oxobutanoic acid |
| SMILES | CC(=O)CC(=O)O.CCOc1cc(-c2cc(Cl)ncn2)ccc1C#N |
| InChI | InChI=1S/C13H10ClN3O.C4H6O3/c1-2-18-12-5-9(3-4-10(12)7-15)11-6-13(14)17-8-16-11;1-3(5)2-4(6)7/h3-6,8H,2H2,1H3;2H2,1H3,(H,6,7) |
| InChIKey | GVJPYOLWSUWUEY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 113.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|