About 1-chloro-N,N-dimethoxymethanamine
1-chloro-N,N-dimethoxymethanamine (PubChem CID 174552952) has the molecular formula C3H8ClNO2
and a molecular weight of 125.56 g/mol. Its IUPAC name is 1-chloro-N,N-dimethoxymethanamine.
Molecular Properties
| Compound Name | 1-chloro-N,N-dimethoxymethanamine |
| PubChem CID | 174552952 |
| Molecular Formula | C3H8ClNO2 |
| Molecular Weight | 125.56 g/mol |
| Exact Mass | 125.02 |
| IUPAC Name | 1-chloro-N,N-dimethoxymethanamine |
| SMILES | CON(CCl)OC |
| InChI | InChI=1S/C3H8ClNO2/c1-6-5(3-4)7-2/h3H2,1-2H3 |
| InChIKey | PKMBRKLYLSMEEF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.56 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-N,N-dimethoxymethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-N,N-dimethoxymethanamine?
The IUPAC name of 1-chloro-N,N-dimethoxymethanamine (CID 174552952) is 1-chloro-N,N-dimethoxymethanamine.
What is the SMILES notation for 1-chloro-N,N-dimethoxymethanamine?
The canonical SMILES for 1-chloro-N,N-dimethoxymethanamine is CON(CCl)OC.
What is the InChIKey of 1-chloro-N,N-dimethoxymethanamine?
The InChIKey is PKMBRKLYLSMEEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8ClNO2/c1-6-5(3-4)7-2/h3H2,1-2H3.
What are the key properties of 1-chloro-N,N-dimethoxymethanamine?
1-chloro-N,N-dimethoxymethanamine has a molecular weight of 125.56 g/mol, XLogP of 0.61, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-N,N-dimethoxymethanamine is sourced from PubChem (CID 174552952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).