About 4-prop-2-enoxybutyl 2-(5-chloroquinolin-8-yl)-2-hydroxyacetate
4-prop-2-enoxybutyl 2-(5-chloroquinolin-8-yl)-2-hydroxyacetate (PubChem CID 174555458) has the molecular formula C18H20ClNO4
and a molecular weight of 349.81 g/mol. Its IUPAC name is 4-prop-2-enoxybutyl 2-(5-chloroquinolin-8-yl)-2-hydroxyacetate.
Molecular Properties
| Compound Name | 4-prop-2-enoxybutyl 2-(5-chloroquinolin-8-yl)-2-hydroxyacetate |
| PubChem CID | 174555458 |
| Molecular Formula | C18H20ClNO4 |
| Molecular Weight | 349.81 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 4-prop-2-enoxybutyl 2-(5-chloroquinolin-8-yl)-2-hydroxyacetate |
| SMILES | C=CCOCCCCOC(=O)C(O)c1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C18H20ClNO4/c1-2-10-23-11-3-4-12-24-18(22)17(21)14-7-8-15(19)13-6-5-9-20-16(13)14/h2,5-9,17,21H,1,3-4,10-12H2 |
| InChIKey | PPMSUQFRKCRHFH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.81 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-prop-2-enoxybutyl 2-(5-chloroquinolin-8-yl)-2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-2-enoxybutyl 2-(5-chloroquinolin-8-yl)-2-hydroxyacetate?
The IUPAC name of 4-prop-2-enoxybutyl 2-(5-chloroquinolin-8-yl)-2-hydroxyacetate (CID 174555458) is 4-prop-2-enoxybutyl 2-(5-chloroquinolin-8-yl)-2-hydroxyacetate.
What is the SMILES notation for 4-prop-2-enoxybutyl 2-(5-chloroquinolin-8-yl)-2-hydroxyacetate?
The canonical SMILES for 4-prop-2-enoxybutyl 2-(5-chloroquinolin-8-yl)-2-hydroxyacetate is C=CCOCCCCOC(=O)C(O)c1ccc(Cl)c2cccnc12.
What is the InChIKey of 4-prop-2-enoxybutyl 2-(5-chloroquinolin-8-yl)-2-hydroxyacetate?
The InChIKey is PPMSUQFRKCRHFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20ClNO4/c1-2-10-23-11-3-4-12-24-18(22)17(21)14-7-8-15(19)13-6-5-9-20-16(13)14/h2,5-9,17,21H,1,3-4,10-12H2.
What are the key properties of 4-prop-2-enoxybutyl 2-(5-chloroquinolin-8-yl)-2-hydroxyacetate?
4-prop-2-enoxybutyl 2-(5-chloroquinolin-8-yl)-2-hydroxyacetate has a molecular weight of 349.81 g/mol, XLogP of 3.45, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-2-enoxybutyl 2-(5-chloroquinolin-8-yl)-2-hydroxyacetate is sourced from PubChem (CID 174555458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).