C22H20ClN3O4S — CID 17455691
2-chloro-N-[2-[3-[methyl(phenyl)sulfamoyl]anilino]-2-oxoethyl]benzamide (PubChem CID 17455691) has the molecular formula C22H20ClN3O4S and a molecular weight of 457.94 g/mol. Its IUPAC name is 2-chloro-N-[2-[3-[methyl(phenyl)sulfamoyl]anilino]-2-oxoethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[3-[methyl(phenyl)sulfamoyl]anilino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 17455691 |
| Molecular Formula | C22H20ClN3O4S |
| Molecular Weight | 457.94 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 2-chloro-N-[2-[3-[methyl(phenyl)sulfamoyl]anilino]-2-oxoethyl]benzamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1cccc(NC(=O)CNC(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C22H20ClN3O4S/c1-26(17-9-3-2-4-10-17)31(29,30)18-11-7-8-16(14-18)25-21(27)15-24-22(28)19-12-5-6-13-20(19)23/h2-14H,15H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | XKMHWHNLHCMZLS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.94 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |