C20H22N4 — CID 174557016
4-[6-(4-cyclopropyl-2-methylpiperazin-1-yl)-3-pyridinyl]benzonitrile (PubChem CID 174557016) has the molecular formula C20H22N4 and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-[6-(4-cyclopropyl-2-methylpiperazin-1-yl)-3-pyridinyl]benzonitrile.
| Compound Name | 4-[6-(4-cyclopropyl-2-methylpiperazin-1-yl)-3-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 174557016 |
| Molecular Formula | C20H22N4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 4-[6-(4-cyclopropyl-2-methylpiperazin-1-yl)-3-pyridinyl]benzonitrile |
| SMILES | CC1CN(C2CC2)CCN1c1ccc(-c2ccc(C#N)cc2)cn1 |
| InChI | InChI=1S/C20H22N4/c1-15-14-23(19-7-8-19)10-11-24(15)20-9-6-18(13-22-20)17-4-2-16(12-21)3-5-17/h2-6,9,13,15,19H,7-8,10-11,14H2,1H3 |
| InChIKey | PAGNODJCGGJVKA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 43.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |