C15H14N8 — CID 133485263
5-[(3R)-4-(5-cyanopyrazin-2-yl)-3-methylpiperazin-1-yl]pyrazine-2-carbonitrile (PubChem CID 133485263) has the molecular formula C15H14N8 and a molecular weight of 306.33 g/mol. Its IUPAC name is 5-[(3R)-4-(5-cyanopyrazin-2-yl)-3-methylpiperazin-1-yl]pyrazine-2-carbonitrile.
| Compound Name | 5-[(3R)-4-(5-cyanopyrazin-2-yl)-3-methylpiperazin-1-yl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133485263 |
| Molecular Formula | C15H14N8 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 5-[(3R)-4-(5-cyanopyrazin-2-yl)-3-methylpiperazin-1-yl]pyrazine-2-carbonitrile |
| SMILES | C[C@@H]1CN(c2cnc(C#N)cn2)CCN1c1cnc(C#N)cn1 |
| InChI | InChI=1S/C15H14N8/c1-11-10-22(14-8-18-12(4-16)6-20-14)2-3-23(11)15-9-19-13(5-17)7-21-15/h6-9,11H,2-3,10H2,1H3/t11-/m1/s1 |
| InChIKey | OMOFNVDFNFJEMH-LLVKDONJSA-N |
| XLogP | 0.73 |
| TPSA | 105.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |