C14H20N6 — CID 126892107
5-[3-(4-ethylpiperazin-1-yl)azetidin-1-yl]pyrazine-2-carbonitrile (PubChem CID 126892107) has the molecular formula C14H20N6 and a molecular weight of 272.36 g/mol. Its IUPAC name is 5-[3-(4-ethylpiperazin-1-yl)azetidin-1-yl]pyrazine-2-carbonitrile.
| Compound Name | 5-[3-(4-ethylpiperazin-1-yl)azetidin-1-yl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 126892107 |
| Molecular Formula | C14H20N6 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 5-[3-(4-ethylpiperazin-1-yl)azetidin-1-yl]pyrazine-2-carbonitrile |
| SMILES | CCN1CCN(C2CN(c3cnc(C#N)cn3)C2)CC1 |
| InChI | InChI=1S/C14H20N6/c1-2-18-3-5-19(6-4-18)13-10-20(11-13)14-9-16-12(7-15)8-17-14/h8-9,13H,2-6,10-11H2,1H3 |
| InChIKey | FHNUFMBDHJMJGI-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 59.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |