C14H19N5O — CID 133485794
5-(3-methyl-4-morpholin-4-ylpyrrolidin-1-yl)pyrazine-2-carbonitrile (PubChem CID 133485794) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is 5-(3-methyl-4-morpholin-4-ylpyrrolidin-1-yl)pyrazine-2-carbonitrile.
| Compound Name | 5-(3-methyl-4-morpholin-4-ylpyrrolidin-1-yl)pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133485794 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 5-(3-methyl-4-morpholin-4-ylpyrrolidin-1-yl)pyrazine-2-carbonitrile |
| SMILES | CC1CN(c2cnc(C#N)cn2)CC1N1CCOCC1 |
| InChI | InChI=1S/C14H19N5O/c1-11-9-19(14-8-16-12(6-15)7-17-14)10-13(11)18-2-4-20-5-3-18/h7-8,11,13H,2-5,9-10H2,1H3 |
| InChIKey | VIOZIQMQRMMASQ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 65.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |