C14H15N5S — CID 133290153
5-[4-(thiophen-2-ylmethyl)piperazin-1-yl]pyrazine-2-carbonitrile (PubChem CID 133290153) has the molecular formula C14H15N5S and a molecular weight of 285.38 g/mol. Its IUPAC name is 5-[4-(thiophen-2-ylmethyl)piperazin-1-yl]pyrazine-2-carbonitrile.
| Compound Name | 5-[4-(thiophen-2-ylmethyl)piperazin-1-yl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133290153 |
| Molecular Formula | C14H15N5S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 5-[4-(thiophen-2-ylmethyl)piperazin-1-yl]pyrazine-2-carbonitrile |
| SMILES | N#Cc1cnc(N2CCN(Cc3cccs3)CC2)cn1 |
| InChI | InChI=1S/C14H15N5S/c15-8-12-9-17-14(10-16-12)19-5-3-18(4-6-19)11-13-2-1-7-20-13/h1-2,7,9-10H,3-6,11H2 |
| InChIKey | ROBSRYWFUIQSHB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 56.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |