C11H11F3NO2S- — CID 174557399
[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanesulfinate (PubChem CID 174557399) has the molecular formula C11H11F3NO2S- and a molecular weight of 278.27 g/mol. Its IUPAC name is [7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanesulfinate.
| Compound Name | [7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanesulfinate |
|---|---|
| PubChem CID | 174557399 |
| Molecular Formula | C11H11F3NO2S- |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | [7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanesulfinate |
| SMILES | O=S([O-])CN1CCc2ccc(C(F)(F)F)cc2C1 |
| InChI | InChI=1S/C11H12F3NO2S/c12-11(13,14)10-2-1-8-3-4-15(7-18(16)17)6-9(8)5-10/h1-2,5H,3-4,6-7H2,(H,16,17)/p-1 |
| InChIKey | VFWMCMWILWARGJ-UHFFFAOYSA-M |
| XLogP | 1.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|