C16H21N2O3S- — CID 175314753
[6-(piperidine-3-carbonyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanesulfinate (PubChem CID 175314753) has the molecular formula C16H21N2O3S- and a molecular weight of 321.42 g/mol. Its IUPAC name is [6-(piperidine-3-carbonyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanesulfinate.
| Compound Name | [6-(piperidine-3-carbonyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanesulfinate |
|---|---|
| PubChem CID | 175314753 |
| Molecular Formula | C16H21N2O3S- |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | [6-(piperidine-3-carbonyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanesulfinate |
| SMILES | O=C(c1ccc2c(c1)CCN(CS(=O)[O-])C2)C1CCCNC1 |
| InChI | InChI=1S/C16H22N2O3S/c19-16(14-2-1-6-17-9-14)13-3-4-15-10-18(11-22(20)21)7-5-12(15)8-13/h3-4,8,14,17H,1-2,5-7,9-11H2,(H,20,21)/p-1 |
| InChIKey | GCGPYGMYHPXELC-UHFFFAOYSA-M |
| XLogP | 1.06 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|