C15H25Cl2N3O3 — CID 174558359
1-(4-aminophenyl)piperidine-4-carboxylic acid;N,N-dimethylformamide;dihydrochloride (PubChem CID 174558359) has the molecular formula C15H25Cl2N3O3 and a molecular weight of 366.29 g/mol. Its IUPAC name is 1-(4-aminophenyl)piperidine-4-carboxylic acid;N,N-dimethylformamide;dihydrochloride.
| Compound Name | 1-(4-aminophenyl)piperidine-4-carboxylic acid;N,N-dimethylformamide;dihydrochloride |
|---|---|
| PubChem CID | 174558359 |
| Molecular Formula | C15H25Cl2N3O3 |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 1-(4-aminophenyl)piperidine-4-carboxylic acid;N,N-dimethylformamide;dihydrochloride |
| SMILES | CN(C)C=O.Cl.Cl.Nc1ccc(N2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C12H16N2O2.C3H7NO.2ClH/c13-10-1-3-11(4-2-10)14-7-5-9(6-8-14)12(15)16;1-4(2)3-5;;/h1-4,9H,5-8,13H2,(H,15,16);3H,1-2H3;2*1H |
| InChIKey | YIRSGYXNAQBWOZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|