C8H11F4NO4 — CID 174558949
methyl 1-fluoropyrrolidine-2-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 174558949) has the molecular formula C8H11F4NO4 and a molecular weight of 261.17 g/mol. Its IUPAC name is methyl 1-fluoropyrrolidine-2-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl 1-fluoropyrrolidine-2-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 174558949 |
| Molecular Formula | C8H11F4NO4 |
| Molecular Weight | 261.17 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | methyl 1-fluoropyrrolidine-2-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)C1CCCN1F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C6H10FNO2.C2HF3O2/c1-10-6(9)5-3-2-4-8(5)7;3-2(4,5)1(6)7/h5H,2-4H2,1H3;(H,6,7) |
| InChIKey | FGCFHVJLVMLEOS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.17 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|