C13H23NO4 — CID 165072023
cyclopentanecarboxylic acid;methyl (2R)-1-methylpyrrolidine-2-carboxylate (PubChem CID 165072023) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is cyclopentanecarboxylic acid;methyl (2R)-1-methylpyrrolidine-2-carboxylate.
| Compound Name | cyclopentanecarboxylic acid;methyl (2R)-1-methylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 165072023 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | cyclopentanecarboxylic acid;methyl (2R)-1-methylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN1C.O=C(O)C1CCCC1 |
| InChI | InChI=1S/C7H13NO2.C6H10O2/c1-8-5-3-4-6(8)7(9)10-2;7-6(8)5-3-1-2-4-5/h6H,3-5H2,1-2H3;5H,1-4H2,(H,7,8)/t6-;/m1./s1 |
| InChIKey | SXSJQNNVQQLRNN-FYZOBXCZSA-N |
| XLogP | 1.51 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |