About bis(2-methylprop-2-enoic acid);1-(1-sulfanylethylsulfanyloxysulfanyl)ethanethiol
bis(2-methylprop-2-enoic acid);1-(1-sulfanylethylsulfanyloxysulfanyl)ethanethiol (PubChem CID 174561234) has the molecular formula C12H22O5S4
and a molecular weight of 374.57 g/mol. Its IUPAC name is bis(2-methylprop-2-enoic acid);1-(1-sulfanylethylsulfanyloxysulfanyl)ethanethiol.
Molecular Properties
| Compound Name | bis(2-methylprop-2-enoic acid);1-(1-sulfanylethylsulfanyloxysulfanyl)ethanethiol |
| PubChem CID | 174561234 |
| Molecular Formula | C12H22O5S4 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | bis(2-methylprop-2-enoic acid);1-(1-sulfanylethylsulfanyloxysulfanyl)ethanethiol |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.CC(S)SOSC(C)S |
| InChI | InChI=1S/2C4H6O2.C4H10OS4/c2*1-3(2)4(5)6;1-3(6)8-5-9-4(2)7/h2*1H2,2H3,(H,5,6);3-4,6-7H,1-2H3 |
| InChIKey | NKZYUXXFKMAEOC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylprop-2-enoic acid);1-(1-sulfanylethylsulfanyloxysulfanyl)ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylprop-2-enoic acid);1-(1-sulfanylethylsulfanyloxysulfanyl)ethanethiol?
The IUPAC name of bis(2-methylprop-2-enoic acid);1-(1-sulfanylethylsulfanyloxysulfanyl)ethanethiol (CID 174561234) is bis(2-methylprop-2-enoic acid);1-(1-sulfanylethylsulfanyloxysulfanyl)ethanethiol.
What is the SMILES notation for bis(2-methylprop-2-enoic acid);1-(1-sulfanylethylsulfanyloxysulfanyl)ethanethiol?
The canonical SMILES for bis(2-methylprop-2-enoic acid);1-(1-sulfanylethylsulfanyloxysulfanyl)ethanethiol is C=C(C)C(=O)O.C=C(C)C(=O)O.CC(S)SOSC(C)S.
What is the InChIKey of bis(2-methylprop-2-enoic acid);1-(1-sulfanylethylsulfanyloxysulfanyl)ethanethiol?
The InChIKey is NKZYUXXFKMAEOC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H6O2.C4H10OS4/c2*1-3(2)4(5)6;1-3(6)8-5-9-4(2)7/h2*1H2,2H3,(H,5,6);3-4,6-7H,1-2H3.
What are the key properties of bis(2-methylprop-2-enoic acid);1-(1-sulfanylethylsulfanyloxysulfanyl)ethanethiol?
bis(2-methylprop-2-enoic acid);1-(1-sulfanylethylsulfanyloxysulfanyl)ethanethiol has a molecular weight of 374.57 g/mol, XLogP of 4.15, 6 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylprop-2-enoic acid);1-(1-sulfanylethylsulfanyloxysulfanyl)ethanethiol is sourced from PubChem (CID 174561234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).