C22H20N4O2 — CID 174561500
4-[1-amino-2-oxo-2-(2-phenylethenylamino)ethyl]-N-pyridin-4-ylbenzamide (PubChem CID 174561500) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 4-[1-amino-2-oxo-2-(2-phenylethenylamino)ethyl]-N-pyridin-4-ylbenzamide.
| Compound Name | 4-[1-amino-2-oxo-2-(2-phenylethenylamino)ethyl]-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 174561500 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 4-[1-amino-2-oxo-2-(2-phenylethenylamino)ethyl]-N-pyridin-4-ylbenzamide |
| SMILES | NC(C(=O)NC=Cc1ccccc1)c1ccc(C(=O)Nc2ccncc2)cc1 |
| InChI | InChI=1S/C22H20N4O2/c23-20(22(28)25-15-10-16-4-2-1-3-5-16)17-6-8-18(9-7-17)21(27)26-19-11-13-24-14-12-19/h1-15,20H,23H2,(H,25,28)(H,24,26,27) |
| InChIKey | ZZANXWSDFZCXRQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |