C28H26N4O2 — CID 67536747
4-[1-amino-2-[[2-(4-phenylphenyl)acetyl]amino]ethyl]-N-pyridin-4-ylbenzamide (PubChem CID 67536747) has the molecular formula C28H26N4O2 and a molecular weight of 450.54 g/mol. Its IUPAC name is 4-[1-amino-2-[[2-(4-phenylphenyl)acetyl]amino]ethyl]-N-pyridin-4-ylbenzamide.
| Compound Name | 4-[1-amino-2-[[2-(4-phenylphenyl)acetyl]amino]ethyl]-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 67536747 |
| Molecular Formula | C28H26N4O2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 4-[1-amino-2-[[2-(4-phenylphenyl)acetyl]amino]ethyl]-N-pyridin-4-ylbenzamide |
| SMILES | NC(CNC(=O)Cc1ccc(-c2ccccc2)cc1)c1ccc(C(=O)Nc2ccncc2)cc1 |
| InChI | InChI=1S/C28H26N4O2/c29-26(23-10-12-24(13-11-23)28(34)32-25-14-16-30-17-15-25)19-31-27(33)18-20-6-8-22(9-7-20)21-4-2-1-3-5-21/h1-17,26H,18-19,29H2,(H,31,33)(H,30,32,34) |
| InChIKey | SROUYFGMXWQRQU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |