C22H23N5O3 — CID 67538548
4-[1-amino-2-[(4-methoxyphenyl)carbamoylamino]ethyl]-N-pyridin-4-ylbenzamide (PubChem CID 67538548) has the molecular formula C22H23N5O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is 4-[1-amino-2-[(4-methoxyphenyl)carbamoylamino]ethyl]-N-pyridin-4-ylbenzamide.
| Compound Name | 4-[1-amino-2-[(4-methoxyphenyl)carbamoylamino]ethyl]-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 67538548 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 4-[1-amino-2-[(4-methoxyphenyl)carbamoylamino]ethyl]-N-pyridin-4-ylbenzamide |
| SMILES | COc1ccc(NC(=O)NCC(N)c2ccc(C(=O)Nc3ccncc3)cc2)cc1 |
| InChI | InChI=1S/C22H23N5O3/c1-30-19-8-6-17(7-9-19)27-22(29)25-14-20(23)15-2-4-16(5-3-15)21(28)26-18-10-12-24-13-11-18/h2-13,20H,14,23H2,1H3,(H,24,26,28)(H2,25,27,29) |
| InChIKey | FCWODXDKZLUIHF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |