C23H24N4O2 — CID 67536660
4-[1-amino-3-[(4-methylphenyl)methylamino]-3-oxopropyl]-N-pyridin-4-ylbenzamide (PubChem CID 67536660) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 4-[1-amino-3-[(4-methylphenyl)methylamino]-3-oxopropyl]-N-pyridin-4-ylbenzamide.
| Compound Name | 4-[1-amino-3-[(4-methylphenyl)methylamino]-3-oxopropyl]-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 67536660 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 4-[1-amino-3-[(4-methylphenyl)methylamino]-3-oxopropyl]-N-pyridin-4-ylbenzamide |
| SMILES | Cc1ccc(CNC(=O)CC(N)c2ccc(C(=O)Nc3ccncc3)cc2)cc1 |
| InChI | InChI=1S/C23H24N4O2/c1-16-2-4-17(5-3-16)15-26-22(28)14-21(24)18-6-8-19(9-7-18)23(29)27-20-10-12-25-13-11-20/h2-13,21H,14-15,24H2,1H3,(H,26,28)(H,25,27,29) |
| InChIKey | HQUMGDIHYHICQS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |