C21H26N4O2 — CID 67538066
4-[1-amino-3-(cyclohexylamino)-3-oxopropyl]-N-pyridin-4-ylbenzamide (PubChem CID 67538066) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 4-[1-amino-3-(cyclohexylamino)-3-oxopropyl]-N-pyridin-4-ylbenzamide.
| Compound Name | 4-[1-amino-3-(cyclohexylamino)-3-oxopropyl]-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 67538066 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 4-[1-amino-3-(cyclohexylamino)-3-oxopropyl]-N-pyridin-4-ylbenzamide |
| SMILES | NC(CC(=O)NC1CCCCC1)c1ccc(C(=O)Nc2ccncc2)cc1 |
| InChI | InChI=1S/C21H26N4O2/c22-19(14-20(26)24-17-4-2-1-3-5-17)15-6-8-16(9-7-15)21(27)25-18-10-12-23-13-11-18/h6-13,17,19H,1-5,14,22H2,(H,24,26)(H,23,25,27) |
| InChIKey | VZOUPMNWZHGCEG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |