C31H36N4O2 — CID 67537013
4-[amino-[1-(2-cyclohexyl-2-phenylacetyl)pyrrolidin-2-yl]methyl]-N-pyridin-4-ylbenzamide (PubChem CID 67537013) has the molecular formula C31H36N4O2 and a molecular weight of 496.66 g/mol. Its IUPAC name is 4-[amino-[1-(2-cyclohexyl-2-phenylacetyl)pyrrolidin-2-yl]methyl]-N-pyridin-4-ylbenzamide.
| Compound Name | 4-[amino-[1-(2-cyclohexyl-2-phenylacetyl)pyrrolidin-2-yl]methyl]-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 67537013 |
| Molecular Formula | C31H36N4O2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | 4-[amino-[1-(2-cyclohexyl-2-phenylacetyl)pyrrolidin-2-yl]methyl]-N-pyridin-4-ylbenzamide |
| SMILES | NC(c1ccc(C(=O)Nc2ccncc2)cc1)C1CCCN1C(=O)C(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C31H36N4O2/c32-29(24-13-15-25(16-14-24)30(36)34-26-17-19-33-20-18-26)27-12-7-21-35(27)31(37)28(22-8-3-1-4-9-22)23-10-5-2-6-11-23/h1,3-4,8-9,13-20,23,27-29H,2,5-7,10-12,21,32H2,(H,33,34,36) |
| InChIKey | QGTRHZWUEKEQKO-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |