C24H26N4O4S — CID 59419418
4-[amino-[1-(4-methoxyphenyl)sulfonylpyrrolidin-2-yl]methyl]-N-pyridin-4-ylbenzamide (PubChem CID 59419418) has the molecular formula C24H26N4O4S and a molecular weight of 466.56 g/mol. Its IUPAC name is 4-[amino-[1-(4-methoxyphenyl)sulfonylpyrrolidin-2-yl]methyl]-N-pyridin-4-ylbenzamide.
| Compound Name | 4-[amino-[1-(4-methoxyphenyl)sulfonylpyrrolidin-2-yl]methyl]-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 59419418 |
| Molecular Formula | C24H26N4O4S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 4-[amino-[1-(4-methoxyphenyl)sulfonylpyrrolidin-2-yl]methyl]-N-pyridin-4-ylbenzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC2C(N)c2ccc(C(=O)Nc3ccncc3)cc2)cc1 |
| InChI | InChI=1S/C24H26N4O4S/c1-32-20-8-10-21(11-9-20)33(30,31)28-16-2-3-22(28)23(25)17-4-6-18(7-5-17)24(29)27-19-12-14-26-15-13-19/h4-15,22-23H,2-3,16,25H2,1H3,(H,26,27,29) |
| InChIKey | VUIAAPPZPIFSPI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |