C23H21F3N4O2 — CID 67536790
4-[1-amino-3-[benzyl(trifluoromethyl)amino]-3-oxopropyl]-N-pyridin-4-ylbenzamide (PubChem CID 67536790) has the molecular formula C23H21F3N4O2 and a molecular weight of 442.44 g/mol. Its IUPAC name is 4-[1-amino-3-[benzyl(trifluoromethyl)amino]-3-oxopropyl]-N-pyridin-4-ylbenzamide.
| Compound Name | 4-[1-amino-3-[benzyl(trifluoromethyl)amino]-3-oxopropyl]-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 67536790 |
| Molecular Formula | C23H21F3N4O2 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 4-[1-amino-3-[benzyl(trifluoromethyl)amino]-3-oxopropyl]-N-pyridin-4-ylbenzamide |
| SMILES | NC(CC(=O)N(Cc1ccccc1)C(F)(F)F)c1ccc(C(=O)Nc2ccncc2)cc1 |
| InChI | InChI=1S/C23H21F3N4O2/c24-23(25,26)30(15-16-4-2-1-3-5-16)21(31)14-20(27)17-6-8-18(9-7-17)22(32)29-19-10-12-28-13-11-19/h1-13,20H,14-15,27H2,(H,28,29,32) |
| InChIKey | DZYJCKNVAKMUJY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|