C22H20F3N5O2S — CID 87436838
4-[1-amino-2-[sulfanyl-[[4-(trifluoromethyl)phenyl]carbamoyl]amino]ethyl]-N-pyridin-4-ylbenzamide (PubChem CID 87436838) has the molecular formula C22H20F3N5O2S and a molecular weight of 475.50 g/mol. Its IUPAC name is 4-[1-amino-2-[sulfanyl-[[4-(trifluoromethyl)phenyl]carbamoyl]amino]ethyl]-N-pyridin-4-ylbenzamide.
| Compound Name | 4-[1-amino-2-[sulfanyl-[[4-(trifluoromethyl)phenyl]carbamoyl]amino]ethyl]-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 87436838 |
| Molecular Formula | C22H20F3N5O2S |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 4-[1-amino-2-[sulfanyl-[[4-(trifluoromethyl)phenyl]carbamoyl]amino]ethyl]-N-pyridin-4-ylbenzamide |
| SMILES | NC(CN(S)C(=O)Nc1ccc(C(F)(F)F)cc1)c1ccc(C(=O)Nc2ccncc2)cc1 |
| InChI | InChI=1S/C22H20F3N5O2S/c23-22(24,25)16-5-7-17(8-6-16)29-21(32)30(33)13-19(26)14-1-3-15(4-2-14)20(31)28-18-9-11-27-12-10-18/h1-12,19,33H,13,26H2,(H,29,32)(H,27,28,31) |
| InChIKey | XKKNRYAIEMGDQD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|