C27H26N4O2 — CID 67537423
4-[1-amino-2-[methyl-(2-naphthalen-1-ylacetyl)amino]ethyl]-N-pyridin-4-ylbenzamide (PubChem CID 67537423) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 4-[1-amino-2-[methyl-(2-naphthalen-1-ylacetyl)amino]ethyl]-N-pyridin-4-ylbenzamide.
| Compound Name | 4-[1-amino-2-[methyl-(2-naphthalen-1-ylacetyl)amino]ethyl]-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 67537423 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 4-[1-amino-2-[methyl-(2-naphthalen-1-ylacetyl)amino]ethyl]-N-pyridin-4-ylbenzamide |
| SMILES | CN(CC(N)c1ccc(C(=O)Nc2ccncc2)cc1)C(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C27H26N4O2/c1-31(26(32)17-22-7-4-6-19-5-2-3-8-24(19)22)18-25(28)20-9-11-21(12-10-20)27(33)30-23-13-15-29-16-14-23/h2-16,25H,17-18,28H2,1H3,(H,29,30,33) |
| InChIKey | JOWXUSKSBZXXHE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |