C24H21N4O3S- — CID 68668615
4-[[4-[1-amino-2-[naphthalen-1-yl(sulfinato)amino]ethyl]benzoyl]amino]pyridine (PubChem CID 68668615) has the molecular formula C24H21N4O3S- and a molecular weight of 445.52 g/mol. Its IUPAC name is 4-[[4-[1-amino-2-[naphthalen-1-yl(sulfinato)amino]ethyl]benzoyl]amino]pyridine.
| Compound Name | 4-[[4-[1-amino-2-[naphthalen-1-yl(sulfinato)amino]ethyl]benzoyl]amino]pyridine |
|---|---|
| PubChem CID | 68668615 |
| Molecular Formula | C24H21N4O3S- |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 4-[[4-[1-amino-2-[naphthalen-1-yl(sulfinato)amino]ethyl]benzoyl]amino]pyridine |
| SMILES | NC(CN(c1cccc2ccccc12)S(=O)[O-])c1ccc(C(=O)Nc2ccncc2)cc1 |
| InChI | InChI=1S/C24H22N4O3S/c25-22(16-28(32(30)31)23-7-3-5-17-4-1-2-6-21(17)23)18-8-10-19(11-9-18)24(29)27-20-12-14-26-15-13-20/h1-15,22H,16,25H2,(H,30,31)(H,26,27,29)/p-1 |
| InChIKey | UJAWXCHAZIMGTD-UHFFFAOYSA-M |
| XLogP | 3.79 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|