C13H17NO5 — CID 174562683
1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;pyrrolidin-2-one (PubChem CID 174562683) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;pyrrolidin-2-one.
| Compound Name | 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;pyrrolidin-2-one |
|---|---|
| PubChem CID | 174562683 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;pyrrolidin-2-one |
| SMILES | CC1(C(=O)O)C=CC=C(C(=O)O)C1.O=C1CCCN1 |
| InChI | InChI=1S/C9H10O4.C4H7NO/c1-9(8(12)13)4-2-3-6(5-9)7(10)11;6-4-2-1-3-5-4/h2-4H,5H2,1H3,(H,10,11)(H,12,13);1-3H2,(H,5,6) |
| InChIKey | LRCHIWBWMWLMBV-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |